Claims
- 1. An indefinitely stable microemulsion which appears as a limpid, thermodynamically stable solution, consisting of the following components:(a) water; (b) a fluoropolyoxyalkylene having hydrogen-containing end groups and/or hydrogen-containing repeating units; (c) a fluorine-free organic initiator for the polymerization of fluoro-containing monomers, selected from alkylperoxides and alkylperoxydicarbonates, soluble in component (b), said component c) is optionally dissolved in a C1-C20 hydrocarbon, of aliphatic, cycloaliphatic, aromatic or mixtures thereof, creating a mixture, optionally the hydrocarbon can contain halogen atoms, said mixture is soluble in component (b); and (d) a fluoro-containing surfactant; wherein the amount of (b) is from 50 to 95% by volume of the total oil phase ((per) fluoropolyethers with end groups H and not, and hydrogen containing part comprising solvents and initiator).
- 2. The microemulsion of claim 1, wherein the fluoropolyoxyalkylenes having hydrogen-containing end groups and/or hydrogen-containing repeating units of component b) are constituted by repeating units, randomly distributed along the chain, selected from:—CFZO—, —CF2CFZO—, —CZ2CF2CF2O—, where Z is H or F, Rf is CF3, C2F5, or C3F7; and by hydrogen-containing end groups selected from —CF2H, —CF2CF2H, —CFH—CF3, and —CFH-ORf, wherein Rf is defined as above, or perfluorinated end groups selected from —CF3, —C2F5 and —C3F7, at least one of the end groups containing hydrogen, the perfluorinated end group can also contain a chlorine atom, for instance of the type CF2CL, CF3—CFCL—CF2,
- 3. The microemulsion of claim 1, wherein the average molecular weight of component b) is comprised between 200 and 4000, and the hydrogen content of component b) is greater than 10 ppm.
- 4. The microemulsion of claim 1, wherein component b) is a mixture of perflourpolyethers (PFPE) containing hydrogen (H) in the end group and/or in the hydrogen repeating units, with PFPE not containing H, containing (per) fluorinated end groups, and optional containing chlorine atoms.
- 5. The microemulsion of claim 1, wherein fluoropolyoxyalkylenes containing hydrogen are selected from the groups consisting of: wherein:T1 and T2, equal to or different from each other, are hydrogen-containing groups —CF2H, —CFH—CF3, or perfluorinated groups —CF3, —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; X is —F or —CF3; a, b, are integers such that the molecular weight is comprised in the above range, a/b are integers such that the molecular weight is comprised in the above range, a/b is comprised between 5 and 15;(b) T3—O(CF2—CF2O)c(CF2O)d—T4 wherein: T3 and T4, equal or different from each other, are hydrogen-containing groups —CF2H or —CF2—CF2H, or perfluorinated groups —CF3, —C2F5; wherein at least one of the end groups contains hydrogen; c, d being integers such that the molecular weight is comprised in the above range, c/d is comprised between 0.3 and 5; wherein:T5 and T6, equal to or different from each other, are hydrogen-containing groups —CF2H, —CF2CF2H, or —CFH—CF3, or perfluorinated groups —CF3, —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; X is —F or —CF3; and e, f, g are integers such that the molecular weight is comprised in the above range, e/(f+g) being comprised between 1 and 10, f/g being comprised between 1 and 10; wherein:T7 and T8 are hydrogen-containing groups —CFH—CF3, or perfluorinated groups —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; h being an integer such that the molecular weight is comprised in the above range;(e) T9—O(CZ2CF2CF2O)i—T10 wherein:Z2 is F or H; T9 and T10, equal to or different from each other, are groups —CF2H, —CF2CF2H, or perfluorinated groups —CF2, —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; i being an integer such that the molecular weight is comprised in the above range; whereinRf is —CF3, —C2F5, or —C3F7; T11 and T12, equal to or different from each other, are groups —CF2H, —CF2CF2H, —CFH—ORf, or perfluorinated groups —CF3, —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; j, k, l being integers such that the molecular weight is comprised in the range indicated above, k+l and j+k+l are at least equal to 2, k/(j+l) is comprised between 10−2 and 103, l/j is comprised between 10−2 and 102; wherein:T13 and T14, equal to or different from each other, are hydrogen-containing groups —CF2H, —CFH—CF3, or perfluorinated groups —CF3, —C2F5, —C3F7, wherein at least one of the end groups contains hydrogen; X is —F or —CF3; m, n, o p being integers such that the molecular weight is comprised in the range indicated above, m/n is comprised between 5 and 40, m/(o+p) is comprised between 2 and 50, o+p is at least 3, o is lower than p;(h) T15—O(CF2CF2O)q(CF2O)r(CFHO)s(CF2CFHO)t—T16 wherein: T15 and T16, equal to or different from each other, are hydrogen-containing groups —CF2H, —CF2CF2H, or perfluorinated groups —CF3, —C2F5, wherein at least one of the end groups contains hydrogen; q, r, s, t are integers such that the molecular weight is comprised in the range indicated above, q/r is comprised between 0.5 and 2, (q+r)/(s+t) is comprised between 3 and 40, s+t is at least 3, s is lower than t; wherein:T17 and T18, equal to or different from each other, are hydrogen-containing groups —CF2H, —CF2CF2H, CHF—CF3 or perfluorinated groups —CF3, —C2F5, wherein at —C3f7, wherein at least one of the end groups contains hydrogen; X is —F or —CF3; u, v, w, x, y are integers such that the molecular weight is comprised in the range indicated above, (u+v)/w is comprised between 5 and 40, (u+v)/(x+y) is comprised between 2 and 50, x+y is at least 3, x is lower than y.
- 6. The microemulsion of claim 1, wherein component d) is of both an ionic and non-ionic sufactant.
- 7. The microemulsion of claim 6, wherein the fluoro-containing surfactant is selected from the anionic ones of formula:Rfb—(CH2)nb—X31 M+wherein nb is an integer from 0 to 6; Rfb is a (per)fluoroalkylic chain C5-C16 or a (per)fluoropolyoxyalkylenic chain as defined above, X−is —COO−or —SO3−, M+is selected from: H+, NH4+, alkali metal ion, the Rfb chain can contain one or more anionic groups described above and the end group Rfb can contain chlorine atoms.
- 8. The microemulsion of claim 1, wherein the amount of radical initiator component c) in the microemulsion is comprised between 0.003% and 5% by weight with respect to the total amount of (co)polymerized monomers.
Priority Claims (1)
| Number |
Date |
Country |
Kind |
| MI95A2264 |
Oct 1995 |
IT |
|
Parent Case Info
This application is a Divisional application of U.S. Ser. No. 08/740,406, filed Oct. 29, 1996, U.S. Pat. No. 6,103,843.
US Referenced Citations (17)
Foreign Referenced Citations (16)
| Number |
Date |
Country |
| 0148482 |
Jul 1985 |
EP |
| 0154297 |
Sep 1985 |
EP |
| 0244839 |
Nov 1987 |
EP |
| 0340739 |
Nov 1989 |
EP |
| 0340740 |
Nov 1989 |
EP |
| 0407937 |
Jan 1991 |
EP |
| 0445738 |
Sep 1991 |
EP |
| 0518073 |
Dec 1992 |
EP |
| 0337346 |
Dec 1993 |
EP |
| 0 612 767 |
Aug 1994 |
EP |
| 0625526 |
Nov 1994 |
EP |
| 0625626 |
Nov 1994 |
EP |
| 0626395 |
Nov 1994 |
EP |
| 0673952 |
Sep 1995 |
EP |
| 0888765 |
Feb 1962 |
GB |
| 1104482 |
Feb 1968 |
GB |