Claims
- 1. A process for preparing a non-symmetric, partially fluorinated composition having a molecular structure:
- 2. A process of claim 1 wherein Rlf is derived from:
(i) F(CF2)xCH2X or H(CF2)xCH2X where x is 1 to 20; (ii) F(CF2CF2)xCH2CH2X where x is 1 to 10; (iii) F(CF2CF2)x(CH2CH2O)yH where x is 1 to 10 and y is 1 to 20; (iv) F(CF(CF3)CF2O)xCF(CF3)CH2X where x is 1 to 12; and (v) mixtures thereof wherein X is —OH, —SH, —NH2 or —NHR′ where R′ is C1 to C40 alkyl.
- 3. A process of claim 2 wherein X is —OH and F′ and F″ are carboxylic esters.
- 4. A non-symmetric, partially fluorinated compound having a molecular structure:
- 5. A compound of claim 4 wherein R1f is derived from:
(i) F(CF2)xCH2X or H(CF2)xCH2X where x is 1 to 20; (ii) F(CF2CF2)xCH2CH2X where x is 1 to 10; (iii) F(CF2CF2)x(CH2CH2O )yH where x is 1 to 10 and y is 1 to 20; (iv) F(CF(CF3)CF2O)xCF(CF3)CH2X where x is 1 to 12; or (v) mixtures thereof wherein X is —OH, —SH, —NH2 or —NHR′ where R″ is C1 to C40 alkyl.
- 6. A non-symmetric, partially fluorinated compound having a molecular structure:
- 7. A lubricant oil formulation comprising:
a) a lubricant oil; and b) at least one non-symmetric, partially fluorinated compound having a molecular structure: R1f—F′—R2—F″—R3h wherein R1f represents a wholly or partially fluorinated C1 to C40 organic residue end group; F and F represent functional linkages which are either alike or different and are selected from the group consisting of thioesters, sulfonic esters, ureas, thioureas, amides, phosphates, thiophosphates, imines, amines, ethers, thioethers, urethanes, thiourethanes, sulfoxides, sulfones, and mixtures thereof; R2 represents the hydrocarbon backbone selected from the group consisting of a C1 to C30 alkyl, C3 to C30 cycloalkyl, aromatic group and mixtures thereof; and R3h represents a non-fluorinated C1 to C40 organic residue end group.
- 8. A lubricant oil formulation of claim 7 wherein R1f is derived from:
(i) F (CF2)xCH2X or H(CF2)xCH2X where x is 1 to 20; (ii) F(CF2CF2)xCH2CH2X where x is 1 to 10; (iii) F(CF2CF2)x(CH2CH2O)yH where x is 1 to 10 and y is 1 to 20; (iv) F(CF(CF3)CF2O)xCF(CF3)CH2X where x is 1 to 12; and (v) mixtures thereof wherein X is —OH, —SH, —NH2 or —NHR′ where R′ is C1 to C40 alkyl.
CROSS-REFERENCE TO RELATED APPLICATIONS
[0001] Applicants claim the benefit of Provisional Application 60/083,115 filed Apr. 27, 1998 and Non-Provisional Application 09/299,251 filed Apr. 26, 1999 now allowed.
Provisional Applications (1)
|
Number |
Date |
Country |
|
60083115 |
Apr 1998 |
US |
Divisions (1)
|
Number |
Date |
Country |
| Parent |
09299251 |
Apr 1999 |
US |
| Child |
10135648 |
Apr 2002 |
US |