Compounds containing elements of the 5th Group of the Periodic System

CCHEMISTRY METALLURGY C07Organic chemistry C07FACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM

C07F9/00Compounds containing elements of the 5th Group of the Periodic System

C07F9/005Compounds of elements of group 5B without metal-carbon linkages C07F9/02Phosphorus compounds C07F9/025Purification; Separation; Stabilisation; Desodorisation of organo-phosphorus compounds C07F9/04Reaction products of phosphorus sulfur compounds with hydrocarbons C07F9/06without P-C bonds C07F9/062Organo-phosphoranes without P-C bonds C07F9/065Phosphoranes containing the structure P=N- C07F9/067Polyphosphazenes containing the structure [P=N-n] C07F9/08Esters of oxyacids of phosphorus C07F9/09Esters of phosphoric acids C07F9/091with hydroxyalkyl compounds with further substituents on alkyl C07F9/092substituted by B, Si or a metal C07F9/093Polyol derivatives esterified at least twice by phosphoric rests C07F9/094with arylalkanols C07F9/095Compounds containing the structure P(=O)-O-acyl, P(=O)-O-heteroatom, P(=O)-O-CN C07F9/096Compounds containing the structure P(=O)-O-C(=X)- (X = O, S, Se) C07F9/097Compounds containing the structure P(=O)-O-N C07F9/098Esters of polyphosphoric acids or anhydrides C07F9/10Phosphatides C07F9/103Extraction or purification by physical or chemical treatment of natural phosphatides; Preparation of compositions containing phosphatides of unknown structure C07F9/106Adducts, complexes, salts of phosphatides C07F9/11with hydroxyalkyl compounds without further substituents on alkyl C07F9/113with unsaturated acyclic alcohols C07F9/117with cycloaliphatic alcohols C07F9/12with hydroxyaryl compounds C07F9/14containing P(=O)-halide groups C07F9/1403containing the structure Hal-P(=O)-O-unsaturated acyclic rest C07F9/1406containing the structure Hal-P(=O)-O-aryl C07F9/141Esters of phosphorous acids C07F9/1411with hydroxyalkyl compounds with further substituents on alkyl C07F9/1412Polyol derivatives esterified at least twice by phosphorous acid rests C07F9/1414with arylalkanols C07F9/1415Compounds containing the structure P-O-acyl, P-O-heteroatom, P-O-CN C07F9/1417Compounds containing the structure P-O-C(=X)- (X = O, S, Se) C07F9/1418Compounds containing the structure P-O-N C07F9/142with hydroxyalkyl compounds without further substituents on alkyl C07F9/143with unsaturated acyclic alcohols C07F9/144with cycloaliphatic alcohols C07F9/145with hydroxyaryl compounds C07F9/146containing P-halide groups C07F9/16Esters of thiophosphoric acids or thiophosphorous acids C07F9/165Esters of thiophosphoric acids C07F9/1651with hydroxyalkyl compounds with further substituents on alkyl C07F9/1652Polyol derivatives esterified at least twice by (thio)phosphoric acid esters C07F9/1653with arylalkanols C07F9/1654Compounds containing the structure P(=X)n-X-acyl, P(=X)n-X-heteroatom, P(=X)n-X-CN (X = O, S, Se; n = 0, 1) C07F9/1655Compounds containing the structure P(=X)n-S-(S)x- (X = O, S, Se; n=0,1; x>=1) C07F9/1656Compounds containing the structure P(=X)n-X-C(=X)- (X = O, S, Se; n = 0, 1) C07F9/1657Compounds containing the structure P(=X)n-X-N (X = O, S, Se; n = 0, 1) C07F9/1658Esters of thiopolyphosphoric acids or anhydrides C07F9/17with hydroxyalkyl compounds without further substituents on alkyl C07F9/173with unsaturated acyclic alcohols C07F9/177with cycloaliphatic alcohols C07F9/18with hydroxyaryl compounds C07F9/20containing P-halide groups C07F9/2003containing the structure Hal-P-X-unsaturated acyclic rest C07F9/2006containing the structure Hal-P-X-aryl C07F9/201Esters of thiophosphorus acids C07F9/2015with hydroxyalkyl compounds with further substituents on alkyl C07F9/202with hydroxyl compounds without further substituents on alkyl C07F9/203with unsaturated acyclic alcohols C07F9/204with cycloaliphatic alcohols C07F9/205with hydroxyaryl compounds C07F9/206containing P-halide groups C07F9/22Amides of acids of phosphorus C07F9/222Amides of phosphoric acids C07F9/224Phosphorus triamides C07F9/226containing the structure P-isocyanates C07F9/228containing the structure P-N-N C07F9/24Esteramides C07F9/2404the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/2408of hydroxyalkyl compounds C07F9/2412of unsaturated acyclic alcohols C07F9/2416of cycloaliphatic alcohols C07F9/242of hydroxyaryl compounds C07F9/2425containing the structure (RX)(RR'N)P(=Y)-Z-(C)n-Z'-P(=Y)(XR)2 (X = O, S, NR; Y = O, S, electron pair; Z = O, S; Z' = O, S) C07F9/2429of arylalkanols C07F9/2433Compounds containing the structure N-P(=X)n-X-acyl, N-P(=X)n-X-heteroatom, N-P(=X)n-X-CN (X = O, S, Se; n = 0, 1) C07F9/2437Compounds containing the structure N-P(=X)n-S-(S)x-(X = O, S, Se; n=0,1; x>=1) C07F9/2441containing the structure N-P(=X)n-X-C(=X) (X = O, S, Se; n = 0, 1) C07F9/2445containing the structure N-P(=X)n-X-N (X = O, S, Se; n = 0, 1) C07F9/245containing the structure N-P(=X)n-X-P (X = O, S, Se; n = 0, 1) C07F9/2454the amide moiety containing a substituent or a structure which is considered as characteristic C07F9/2458of aliphatic amines C07F9/2462of unsaturated acyclic amines C07F9/2466of cycloaliphatic amines C07F9/247of aromatic amines (N-C aromatic linkage) C07F9/2475of aralkylamines C07F9/2479Compounds containing the structure P(=X)n-N-acyl, P(=X)n-N-heteroatom, P(=X)n-N-CN (X = O, S, Se; n = 0, 1) C07F9/2483containing the structure P(=X)n-N-S (X = O, S, Se; n = 0, 1) C07F9/2487containing the structure P(=X)n-N-C(=X) (X = O, S, Se; n = 0, 1) C07F9/2491containing the structure P(=X)n-N-N (X = O, S, Se; n = 0, 1) C07F9/2495containing the structure P(=X)n-N-P (X = O, S, Se; n = 0, 1) C07F9/26containing P-halide groups C07F9/28with one or more P-C bonds C07F9/30Phosphinic acids R2P(=O)(OH) Thiophosphinic acids C07F9/301Acyclic saturated acids which can have further substituents on alkyl C07F9/302Acyclic unsaturated acids C07F9/303Cycloaliphatic acids C07F9/304Aromatic acids (P-C aromatic linkage) C07F9/305Poly(thio)phosphinic acids C07F9/306Arylalkanephosphinic acids C07F9/307Acids containing the structure -C(=X)-P(=X)(R)(XH) or NC-P(=X)(R)(XH), (X = O, S, Se) C07F9/308Pyrophosphinic acids; Phosphinic acid anhydrides C07F9/32Esters thereof C07F9/3205the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/3211Esters of acyclic saturated acids which can have further substituents on alkyl C07F9/3217Esters of acyclic unsaturated acids C07F9/3223Esters of cycloaliphatic acids C07F9/3229Esters of aromatic acids (P-C aromatic linkage) C07F9/3235Esters of poly(thio)phosphinic acids C07F9/3241Esters of arylalkanephosphinic acids C07F9/3247Esters of acids containing the structure -C(=X)-P(=X)(R)(XH) or NC-P(=X)(R)(XH), (X = O, S, Se) C07F9/3252containing the structure -C(=X)-P(=X)(R)(XR), (X = O, S, Se) C07F9/3258the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/3264Esters with hydroxyalkyl compounds C07F9/327Esters with unsaturated acyclic alcohols C07F9/3276Esters with cycloaliphatic alcohols C07F9/3282Esters with hydroxyaryl compounds C07F9/3288Esters with arylalkanols C07F9/3294Compounds containing the structure R2P(=X)-X-acyl, R2P(=X)-X-heteroatom, R2P(=X)-X-CN (X = O, S, Se) C07F9/34Halides thereof C07F9/36Amides thereof C07F9/38Phosphonic acids RP(=O)(OH)2 Thiophosphonic acids C07F9/3804not used, see subgroups C07F9/3808Acyclic saturated acids which can have further substituents on alkyl C07F9/3813N-Phosphonomethylglycine; Salts or complexes thereof C07F9/3817Acids containing the structure (RX)2P(=X)-alk-N...P (X = O, S, Se) C07F9/3821substituted by B, Si, P or a metal C07F9/3826Acyclic unsaturated acids C07F9/383Cycloaliphatic acids C07F9/3834Aromatic acids (P-C aromatic linkage) C07F9/3839Polyphosphonic acids C07F9/3843containing no further substituents than -PO3H2 groups C07F9/3847Acyclic unsaturated derivatives C07F9/3852Cycloaliphatic derivatives C07F9/3856containing halogen or nitro(so) substituents C07F9/386containing hydroxy substituents in the hydrocarbon radicals C07F9/3865containing sulfur substituents C07F9/3869containing carboxylic acid or carboxylic acid derivative substituents C07F9/3873containing nitrogen substituents C07F9/3878containing substituents selected from B, Si, P or a metal C07F9/3882Arylalkanephosphonic acids C07F9/3886Acids containing the structure -C(=X)-P(=X)(XH)2 or NC-P(=X)(XH)2, (X = O, S, Se) C07F9/3891Acids containing the structure -C(=X)-P(=X)(XH)2, (X = O, S, Se) C07F9/3895Pyrophosphonic acids; phosphonic acid anhydrides C07F9/40Esters thereof C07F9/4003the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/4006Esters of acyclic acids which can have further substituents on alkyl C07F9/4009Esters containing the structure (RX)2P(=X)-alk-N...P (X = O, S, Se) C07F9/4012substituted by B, Si, P or a metal C07F9/4015Esters of acyclic unsaturated acids C07F9/4018Esters of cycloaliphatic acids C07F9/4021Esters of aromatic acids (P-C aromatic linkage) C07F9/4025Esters of poly(thio)phosphonic acids C07F9/4028containing no further substituents than -PO3H2 groups in free or esterified form C07F9/4031Acyclic unsaturated derivatives C07F9/4034Cycloaliphatic derivatives C07F9/4037containing halogen or nitro(so) substituents C07F9/404containing hydroxy substituents in the hydrocarbon radicals C07F9/4043containing sulfur substituents C07F9/4046containing carboxylic acid or carboxylic acid derivative substituents C07F9/405containing nitrogen substituents C07F9/4053containing substituents selected from B, Si, P , or a metal C07F9/4056Esters of arylalkanephosphonic acids C07F9/4059n-C(=O)-(CH2)m-Ar, (X, Y = O, S, Se; n>=1, m>=0) C07F9/4062Esters of acids containing the structure -C(=X)-P(=X)(XR)2 or NC-P(=X)(XR)2, (X = O, S, Se) C07F9/4065Esters of acids containing the structure -C(=X)-P(=X)(XR)2, (X = O, S, Se) C07F9/4068Esters of pyrophosphonic acids; Esters of phosphonic acid anhydrides C07F9/4071the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/4075Esters with hydroxyalkyl compounds C07F9/4078Esters with unsaturated acyclic alcohols C07F9/4081Esters with cycloaliphatic alcohols C07F9/4084Esters with hydroxyaryl compounds C07F9/4087Esters with arylalkanols C07F9/409Compounds containing the structure P(=X)-X-acyl, P(=X) -X-heteroatom, P(=X)-X-CN (X = O, S, Se) C07F9/4093Compounds containing the structure P(=X)-X-C(=X)- (X = O, S, Se) C07F9/4096Compounds containing the structure P(=X)-X-N (X = O, S, Se) C07F9/42Halides thereof C07F9/425Acid or estermonohalides thereof C07F9/44Amides thereof C07F9/4403the acid moiety containing a substituent or a structure which is considered as characteristic C07F9/4407Amides of acyclic saturated acids which can have further substituents on alkyl C07F9/4411Amides of acyclic unsaturated acids C07F9/4415Amides of cycloaliphatic acids C07F9/4419Amides of aromatic acids (P-C aromatic linkage) C07F9/4423Amides of poly (thio)phosphonic acids C07F9/4426Amides of arylalkanephosphonic acids C07F9/443Amides of acids containing the structure -C(=Y)-P(=X)(XR)-N or NC-(P(=X)(XR)-N ) C07F9/4434the ester moiety containing a substituent or a structure which is considered as characteristic C07F9/4438Ester with hydroxyalkyl compounds C07F9/4442Esters with unsaturated acyclic alcohols C07F9/4446Esters with cycloaliphatic alcohols C07F9/4449Esters with hydroxyaryl compounds C07F9/4453Esters with arylalkanols C07F9/4457Compounds containing the structure C-P(=X)(X-acyl)-N, C-P(=X)(X-heteroatom)-N or C-P(=X)(X-CN)-N (X, Y = O, S) C07F9/4461the amide moiety containing a substituent or a structure which is considered as characteristic C07F9/4465of aliphatic amines C07F9/4469of unsaturated acyclic amines C07F9/4473of cycloaliphatic amines C07F9/4476of aromatic amines (N-C aromatic linkage) C07F9/448of aralkylamines C07F9/4484Compounds containing the structure C-P(=X)(N-acyl)-X, C-P(=X)(N-heteroatom)-X or C-P(=X)(N-CN)-X (X = O, S, Se) C07F9/4488Compounds containing the structure P(=X)(N-S-) (X = O, S, Se) C07F9/4492Compounds containing the structure P(=X)(N-C(=X)-) (X = O, S, Se) C07F9/4496Compounds containing the structure P(=X)(N-N-) (X = O, S, Se) C07F9/46Phosphinous acids R2=P-OH Thiophosphinous acids Aminophosphines R2-P-NH2 including R2P(=O)H; derivatives thereof C07F9/48Phosphonous acids R-P(OH)2 Thiophosphonous acids including RHP(=O)(OH); Derivatives thereof C07F9/4808the acid moiety containing a substituent or structure which is considered as characteristic C07F9/4816Acyclic saturated acids or derivatices which can have further substituents on akyl C07F9/4825Acyclic unsaturated acids or derivatives C07F9/4833Cycloaliphatic acids or derivatives C07F9/4841Aromatic acids or derivatives (P-C aromatic linkage) C07F9/485Polyphosphonous acids or derivatives C07F9/4858Acids or derivatives containing the structure -C(=X)-P(XR)2 or NC-P(XR)2 (X = O, S, Se) C07F9/4866the ester moiety containing a substituent or structure which is considered as characteristic C07F9/4875Esters with hydroxy aryl compounds C07F9/4883Amides or esteramides thereof C07F9/4891Monohalide derivatives RP (XR') (Hal) (X = O, S, N) C07F9/50Organo-phosphines C07F9/5004Acyclic saturated phosphines C07F9/5009substituted by B, Si, P or a metal C07F9/5013Acyclic unsaturated phosphines C07F9/5018Cycloaliphatic phosphines C07F9/5022Aromatic phosphines (P-C aromatic linkage) C07F9/5027Polyphosphines C07F9/5031Arylalkane phosphines C07F9/5036Phosphines containing the structure -C(=X)-P or NC-P C07F9/504Organo-phosphines containing a P-P bond C07F9/5045Complexes or chelates of phosphines with metallic compounds or metals C07F9/505Preparation; Separation; Purification; Stabilisation C07F9/5054by a process in which the phosphorus atom is not involved C07F9/5059by addition of phosphorus compounds to alkenes or alkynes C07F9/5063from compounds having the structure P-H or P-Heteroatom, in which one or more of such bonds are converted into P-C bonds C07F9/5068from starting materials having the structure >P-Hal C07F9/5072from starting materials having the structure P-H C07F9/5077from starting materials having the structure P-Metal, including R2P-M+ C07F9/5081from starting materials having the structure >P-Het, Het being an heteroatom different from Hal or Metal C07F9/5086from phosphonium salts as starting materials C07F9/509by reduction of pentavalent phosphorus derivatives C07F9/5095Separation; Purification; Stabilisation C07F9/52Halophosphines C07F9/53Organo-phosphine oxides Organo-phosphine thioxides C07F9/5304Acyclic saturated phosphine oxides or thioxides C07F9/5308substituted by B, Si, P or a metal C07F9/5312substituted by a phosphorus atom C07F9/5316Unsaturated acyclic phosphine oxides or thioxides C07F9/532Cycloaliphatic phosphine oxides or thioxides C07F9/5325Aromatic phosphine oxides or thioxides (P-C aromatic linkage) C07F9/5329Polyphosphine oxides or thioxides C07F9/5333Arylalkane phosphine oxides or thioxides C07F9/5337Phosphine oxides or thioxides containing the structure -C(=X)-P(=X) or NC-P(=X) (X = O, S, Se) C07F9/5341Organo-phosphine oxides or thioxides containing a P-P bond C07F9/5345Complexes or chelates of phosphine-oxides or thioxides with metallic compounds or metals C07F9/535Organo-phosphoranes C07F9/5352Phosphoranes containing the structure P=C- C07F9/5355Phosphoranes containing the structure P=N- C07F9/5357Polyphosphazenes containing the structure [P=N-n] C07F9/54Quarternary phosphonium compounds C07F9/5407Acyclic saturated phosphonium compounds C07F9/5414substituted by B, Si, P or a metal C07F9/5421substituted by a phosphorus atom C07F9/5428Acyclic unsaturated phosphonium compounds C07F9/5435Cycloaliphatic phosphonium compounds C07F9/5442Aromatic phosphonium compounds (P-C aromatic linkage) C07F9/5449Polyphosphonium compounds C07F9/5456Arylalkanephosphonium compounds C07F9/5463Compounds of the type "quasi-phosphonium" C07F9/547Heterocyclic compounds C07F9/5475having nitrogen and selenium with or without oxygen or sulfur as ring hetero atoms; having nitrogen and tellurium with or without oxygen or sulfur as ring hetero atoms C07F9/553having one nitrogen atom as the only ring hetero atom C07F9/5532Seven-(or more) membered rings C07F9/5535condensed with carbocyclic rings or ring systems C07F9/5537the heteroring containing the structure -C(=O)-N-C(=O)- (both carbon atoms belong to the heteroring) C07F9/564Three-membered rings C07F9/568Four-membered rings C07F9/5683the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/5686condensed with carbocyclic rings or ring systems C07F9/572Five-membered rings C07F9/5721the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/5722the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/5723the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/5725bonded through a heteroatom C07F9/5726directly bonded C07F9/5727the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/5728condensed with carbocyclic rings or carbocyclic ring systems C07F9/576Six-membered rings C07F9/5765condensed with carbocyclic rings or carbocyclic ring systems C07F9/58Pyridine rings C07F9/581the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/582the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/584the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/585bonded through a heteroatom C07F9/587directly bonded C07F9/588the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/59Hydrogenated pyridine rings C07F9/591the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/592the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/594the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/595bonded through a heteroatom C07F9/597directly bonded C07F9/598the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/60Quinoline or hydrogenated quinoline ring systems C07F9/62Isoquinoline or hydrogenated isoquinoline ring systems C07F9/64Acridine or hydrogenated acridine ring systems C07F9/645having two nitrogen atoms as the only ring hetero atoms C07F9/6503Five-membered rings C07F9/65031having the nitrogen atoms in the positions 1 and 2 C07F9/65032the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/65033the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65034the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/65035bonded through a heteroatom C07F9/65036directly bonded C07F9/65037the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/65038condensed with carbocyclic rings or carbocyclic ring systems C07F9/6506having the nitrogen atoms in positions 1 and 3 C07F9/65061the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/65062the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65063the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/65065bonded through a heteroatom C07F9/65066directly bonded C07F9/65067the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/65068condensed with carbocyclic rings or carbocyclic ring systems C07F9/6509Six-membered rings C07F9/650905having the nitrogen atoms in the positions 1 and 2 C07F9/650911the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/650917the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/650923the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/650929bonded through a heteroatom C07F9/650935directly bonded C07F9/650941the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/650947condensed with carbocyclic rings or carbocyclic ring systems C07F9/650952having the nitrogen atoms in the position 1 and 4 C07F9/650958the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/650964the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65097the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/650976bonded through a heteroatom C07F9/650982directly bonded C07F9/650988the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/650994condensed with carbocyclic rings or carbocyclic ring systems C07F9/6512having the nitrogen atoms in positions 1 and 3 C07F9/65121the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/65122the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65123the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/65125bonded through a heteroatom C07F9/65126directly bonded C07F9/65127the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/65128condensed with carbocyclic rings or carbocyclic ring systems C07F9/6515having three nitrogen atoms as the only ring hetero atoms C07F9/6518Five-membered rings C07F9/65181the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/65182the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65183the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/65185bonded through a heteroatom C07F9/65186directly bonded C07F9/65187the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/65188condensed with carbocyclic rings or carbocyclic ring systems C07F9/6521Six-membered rings C07F9/65211the phosphorus atom is bonded to a cyclic nitrogen atom, directly, through one or more heteroatoms or through a hydrocarbon chain which may be broken by one or more heteroatoms C07F9/65212the phosphorus atom is bonded to a cyclic carbon atom, other than directly, through a heteroatom, or through a hydrocarbon chain which may be broken by at least one nitrogen atom C07F9/65213the phosphorus atom is bonded to a cyclic carbon atom, directly or through a heteroatom other than nitrogen C07F9/65215bonded through a heteroatom C07F9/65216directly bonded C07F9/65217the phosphorus atom is bonded to a cyclic carbon atom, through a nitrogen atom or through a hydrocarbon chain which is broken by at least one nitrogen atom C07F9/65218condensed with carbocyclic rings or carbocyclic ring systems C07F9/6524having four or more nitrogen atoms as the only ring hetero atoms C07F9/6527having nitrogen and oxygen atoms as the only ring hetero atoms C07F9/653Five-membered rings C07F9/65306containing two nitrogen atoms C07F9/65312having the two nitrogen atoms in positions 1 and 2 C07F9/65318having the two nitrogen atoms in positions 1 and 3 C07F9/65324condensed with carbocyclic rings or carbocyclic ring systems C07F9/6533Six-membered rings C07F9/65335condensed with carbocyclic rings or carbocyclic ring systems C07F9/6536having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms C07F9/6539Five-membered rings C07F9/65392containing two nitrogen atoms C07F9/65395having the two nitrogen atoms in positions 1 and 2 C07F9/65397having the two nitrogen atoms in positions 1 and 3 C07F9/6541condensed with carbocyclic rings or carbocyclic ring systems C07F9/6544Six-membered rings C07F9/6547condensed with carbocyclic rings or carbocyclic ring systems C07F9/655having oxygen atoms, with or without sulfur, selenium, or tellurium atoms, as the only ring hetero atoms C07F9/65502the oxygen atom being part of a three-membered ring C07F9/65505Phosphonic acids containing oxirane groups; esters thereof C07F9/65507condensed with carbocyclic rings or carbocyclic ring systems C07F9/6551the oxygen atom being part of a four-membered ring C07F9/65512condensed with carbocyclic rings or carbocyclic ring systems C07F9/65515the oxygen atom being part of a five-membered ring C07F9/65517condensed with carbocyclic rings or carbocyclic ring systems C07F9/6552the oxygen atom being part of a six-membered ring C07F9/65522condensed with carbocyclic rings or carbocyclic ring systems C07F9/65525the oxygen atom being part of a seven-(or more) membered ring C07F9/65527condensed with carbocyclic rings or carbocyclic ring systems C07F9/6553having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms C07F9/655309the sulfur atom being part of a three-membered ring C07F9/655318condensed with carbocyclic rings or carbocyclic ring systems C07F9/655327the sulfur atom being part of a four-membered ring C07F9/655336condensed with carbocyclic rings or carbocyclic ring systems C07F9/655345the sulfur atom being part of a five-membered ring C07F9/655354condensed with carbocyclic rings or carbocyclic ring systems C07F9/655363the sulfur atom being part of a six-membered ring C07F9/655372condensed with carbocyclic rings or carbocyclic ring systems C07F9/655381the sulfur atom being part of a seven-(or more) membered ring C07F9/65539condensed with carbocyclic rings or carbocyclic ring systems C07F9/6558containing at least two different or differently substituted hetero rings neither condensed among themselves nor condensed with a common carbocyclic ring or ring system C07F9/65583each of the hetero rings containing nitrogen as ring hetero atom C07F9/65586at least one of the hetero rings does not contain nitrogen as ring hetero atom C07F9/6561containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings C07F9/65611containing the ring system (X = CH2, O, S, NH) optionally with an additional double bond and/or substituents C07F9/65613containing the ring system (X = CH2, O, S, NH) optionally with an additional double bond and/or substituents C07F9/65615containing a spiro condensed ring system of the formula where at least one of the atoms X or Y is a hetero atom C07F9/65616containing the ring system having three or more than three double bonds between ring members or between ring members and non-ring members C07F9/65618containing the ring system C07F9/6564having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms C07F9/6568having phosphorus atoms as the only ring hetero atoms C07F9/65681the ring phosphorus atom being part of a (thio)phosphinic acid or ester thereof C07F9/65683the ring phosphorus atom being part of a phosphine C07F9/65685the ring phosphorus atom being part of a phosphine oxide or thioxide C07F9/65686the ring phosphorus atom being part of an organo-phosphorane C07F9/65688the ring phosphorus atom being part of a phosphonium compound C07F9/6571having phosphorus and oxygen atoms as the only ring hetero atoms C07F9/657109esters of oxyacids of phosphorus in which one or more exocyclic oxygen atoms have been replaced by (a) sulfur atom(s) C07F9/657118non-condensed with carbocyclic rings or heterocyclic rings or ring systems C07F9/657127condensed with carbocyclic or heterocyclic rings or ring systems C07F9/657136the molecule containing more than one cyclic phosphorus atom C07F9/657145the cyclic phosphorus atom belonging to more than one ring system C07F9/657154Cyclic esteramides of oxyacids of phosphorus C07F9/657163the ring phosphorus atom being bound to at least one carbon atom C07F9/657172the ring phosphorus atom and one oxygen atom being part of a (thio)phosphinic acid ester: (X = O, S) C07F9/657181the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonic acid derivative C07F9/65719the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonous acid derivative C07F9/6574Esters of oxyacids of phosphorus C07F9/65742non-condensed with carbocyclic rings or heterocyclic rings or ring systems C07F9/65744condensed with carbocyclic or heterocyclic rings or ring systems C07F9/65746the molecule containing more than one cyclic phosphorus atom C07F9/65748the cyclic phosphorus atom belonging to more than one ring system C07F9/6578having phosphorus and sulfur atoms with or without oxygen atoms, as ring hetero atoms C07F9/65785the ring phosphorus atom and , at least, one ring sulfur atom being part of a thiophosphonic acid derivative C07F9/6581having phosphorus and nitrogen atoms with or without oxygen or sulfur atoms, as ring hetero atoms C07F9/65811having four or more phosphorus atoms as ring hetero atoms C07F9/65812Cyclic phosphazenes [P=N-n, n>=3] C07F9/65814n = 3 or 4 C07F9/65815n = 3 C07F9/65817n = 4 C07F9/65818n > 4 C07F9/6584having one phosphorus atom as ring hetero atom C07F9/65842Cyclic amide derivatives of acids of phosphorus, in which one nitrogen atom belongs to the ring C07F9/65844the phosphorus atom being part of a five-membered ring which may be condensed with another ring system C07F9/65846the phosphorus atom being part of a six-membered ring which may be condensed with another ring system C07F9/65848Cyclic amide derivatives of acids of phosphorus, in which two nitrogen atoms belong to the ring C07F9/6587having two phosphorus atoms as ring hetero atoms in the same ring C07F9/659having three phosphorus atoms as ring hetero atoms in the same ring C07F9/6596having atoms other than oxygen, sulfur, selenium, tellurium, nitrogen or phosphorus as ring hetero atoms C07F9/66Arsenic compounds C07F9/68without As-C bonds C07F9/70Organo-arsenic compounds C07F9/703Complex metallic compounds C07F9/706Heterocyclic compounds containing As in the ring C07F9/72Aliphatic compounds C07F9/723As bound only to carbon, hydrogen and/or oxygen C07F9/726Compounds with chains of As C07F9/74Aromatic compounds C07F9/743As bound only to carbon, hydrogen and/or oxygen C07F9/746Compounds with chains of As C07F9/76containing hydroxyl groups C07F9/78containing amino groups C07F9/80Heterocyclic compounds C07F9/803As bound only to carbon, hydrogen and/or oxygen C07F9/806Compounds with chains of As C07F9/82Arsenic compounds containing one or more pyridine rings C07F9/84Arsenic compounds containing one or more quinoline ring systems C07F9/86Arsenic compounds containing one or more isoquinoline ring systems C07F9/88Arsenic compounds containing one or more acridine ring systems C07F9/90Antimony compounds C07F9/902Compounds without antimony-carbon linkages C07F9/904Aliphatic compounds C07F9/906Heterocyclic compounds C07F9/908Complex compounds C07F9/92Aromatic compounds C07F9/94Bismuth compounds